C17H20F3N3O — CID 71088526
(3'R,8S)-3'-amino-9-methyl-3-(trifluoromethyl)spiro[5,9,9a,10-tetrahydropyrrolo[1,2-b][2,6]naphthyridine-8,1'-cyclopentane]-7-one (PubChem CID 71088526) has the molecular formula C17H20F3N3O and a molecular weight of 339.36 g/mol. Its IUPAC name is (3'R,8S)-3'-amino-9-methyl-3-(trifluoromethyl)spiro[5,9,9a,10-tetrahydropyrrolo[1,2-b][2,6]naphthyridine-8,1'-cyclopentane]-7-one.
| Compound Name | (3'R,8S)-3'-amino-9-methyl-3-(trifluoromethyl)spiro[5,9,9a,10-tetrahydropyrrolo[1,2-b][2,6]naphthyridine-8,1'-cyclopentane]-7-one |
|---|---|
| PubChem CID | 71088526 |
| Molecular Formula | C17H20F3N3O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (3'R,8S)-3'-amino-9-methyl-3-(trifluoromethyl)spiro[5,9,9a,10-tetrahydropyrrolo[1,2-b][2,6]naphthyridine-8,1'-cyclopentane]-7-one |
| SMILES | CC1C2Cc3cnc(C(F)(F)F)cc3CN2C(=O)[C@]12CC[C@@H](N)C2 |
| InChI | InChI=1S/C17H20F3N3O/c1-9-13-4-10-7-22-14(17(18,19)20)5-11(10)8-23(13)15(24)16(9)3-2-12(21)6-16/h5,7,9,12-13H,2-4,6,8,21H2,1H3/t9?,12-,13?,16+/m1/s1 |
| InChIKey | JNNWHQLSAPIPGQ-WERUQRNVSA-N |
| XLogP | 2.50 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |