C27H51FO8 — CID 71088529
ethyl 3-fluoro-2-[(3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-hydroxyoxan-2-yl]propanoate (PubChem CID 71088529) has the molecular formula C27H51FO8 and a molecular weight of 522.70 g/mol. Its IUPAC name is ethyl 3-fluoro-2-[(3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-hydroxyoxan-2-yl]propanoate.
| Compound Name | ethyl 3-fluoro-2-[(3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-hydroxyoxan-2-yl]propanoate |
|---|---|
| PubChem CID | 71088529 |
| Molecular Formula | C27H51FO8 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.36 |
| IUPAC Name | ethyl 3-fluoro-2-[(3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-hydroxyoxan-2-yl]propanoate |
| SMILES | CCCCOC[C@H]1OC(O)(C(CF)C(=O)OCC)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C27H51FO8/c1-6-11-15-31-20-22-23(33-16-12-7-2)24(34-17-13-8-3)25(35-18-14-9-4)27(30,36-22)21(19-28)26(29)32-10-5/h21-25,30H,6-20H2,1-5H3/t21?,22-,23-,24+,25-,27?/m1/s1 |
| InChIKey | KLTXJFUKFLHAQB-JZXYLQTJSA-N |
| XLogP | 4.60 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|