C27H52O7 — CID 71088532
ethyl 2-[(2S,3S,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-methyloxan-2-yl]acetate (PubChem CID 71088532) has the molecular formula C27H52O7 and a molecular weight of 488.71 g/mol. Its IUPAC name is ethyl 2-[(2S,3S,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-methyloxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,3S,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-methyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 71088532 |
| Molecular Formula | C27H52O7 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.37 |
| IUPAC Name | ethyl 2-[(2S,3S,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-methyloxan-2-yl]acetate |
| SMILES | CCCCOC[C@H]1O[C@@](C)(CC(=O)OCC)[C@@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C27H52O7/c1-7-12-16-29-21-22-24(31-17-13-8-2)25(32-18-14-9-3)26(33-19-15-10-4)27(6,34-22)20-23(28)30-11-5/h22,24-26H,7-21H2,1-6H3/t22-,24-,25+,26+,27+/m1/s1 |
| InChIKey | HDVRIEQTFLHJEL-OSXMURCFSA-N |
| XLogP | 5.47 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|