C34H50N6O3S — CID 71088587
2-N-[4-[(1R,2S,4R)-2,4-bis(dimethylamino)cyclohexyl]-5-methyl-2-propan-2-yloxyphenyl]-5-methyl-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine (PubChem CID 71088587) has the molecular formula C34H50N6O3S and a molecular weight of 622.88 g/mol. Its IUPAC name is 2-N-[4-[(1R,2S,4R)-2,4-bis(dimethylamino)cyclohexyl]-5-methyl-2-propan-2-yloxyphenyl]-5-methyl-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-[(1R,2S,4R)-2,4-bis(dimethylamino)cyclohexyl]-5-methyl-2-propan-2-yloxyphenyl]-5-methyl-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 71088587 |
| Molecular Formula | C34H50N6O3S |
| Molecular Weight | 622.88 g/mol |
| Exact Mass | 622.37 |
| IUPAC Name | 2-N-[4-[(1R,2S,4R)-2,4-bis(dimethylamino)cyclohexyl]-5-methyl-2-propan-2-yloxyphenyl]-5-methyl-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ncc(C)c(Nc3ccccc3S(=O)(=O)C(C)C)n2)c(OC(C)C)cc1[C@H]1CC[C@@H](N(C)C)C[C@@H]1N(C)C |
| InChI | InChI=1S/C34H50N6O3S/c1-21(2)43-31-19-27(26-16-15-25(39(7)8)18-30(26)40(9)10)23(5)17-29(31)37-34-35-20-24(6)33(38-34)36-28-13-11-12-14-32(28)44(41,42)22(3)4/h11-14,17,19-22,25-26,30H,15-16,18H2,1-10H3,(H2,35,36,37,38)/t25-,26-,30+/m1/s1 |
| InChIKey | SKRODSHFMOTZJX-MQNCWCGJSA-N |
| XLogP | 6.68 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.88 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |