About 2-butan-2-yl-3-chloro-5,7-difluoro-1-benzothiophene
2-butan-2-yl-3-chloro-5,7-difluoro-1-benzothiophene (PubChem CID 71088766) has the molecular formula C12H11ClF2S
and a molecular weight of 260.74 g/mol. Its IUPAC name is 2-butan-2-yl-3-chloro-5,7-difluoro-1-benzothiophene.
Molecular Properties
| Compound Name | 2-butan-2-yl-3-chloro-5,7-difluoro-1-benzothiophene |
| PubChem CID | 71088766 |
| Molecular Formula | C12H11ClF2S |
| Molecular Weight | 260.74 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 2-butan-2-yl-3-chloro-5,7-difluoro-1-benzothiophene |
| SMILES | CCC(C)c1sc2c(F)cc(F)cc2c1Cl |
| InChI | InChI=1S/C12H11ClF2S/c1-3-6(2)11-10(13)8-4-7(14)5-9(15)12(8)16-11/h4-6H,3H2,1-2H3 |
| InChIKey | GSFSVXNFUVYYRO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.74 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butan-2-yl-3-chloro-5,7-difluoro-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-3-chloro-5,7-difluoro-1-benzothiophene?
The IUPAC name of 2-butan-2-yl-3-chloro-5,7-difluoro-1-benzothiophene (CID 71088766) is 2-butan-2-yl-3-chloro-5,7-difluoro-1-benzothiophene.
What is the SMILES notation for 2-butan-2-yl-3-chloro-5,7-difluoro-1-benzothiophene?
The canonical SMILES for 2-butan-2-yl-3-chloro-5,7-difluoro-1-benzothiophene is CCC(C)c1sc2c(F)cc(F)cc2c1Cl.
What is the InChIKey of 2-butan-2-yl-3-chloro-5,7-difluoro-1-benzothiophene?
The InChIKey is GSFSVXNFUVYYRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClF2S/c1-3-6(2)11-10(13)8-4-7(14)5-9(15)12(8)16-11/h4-6H,3H2,1-2H3.
What are the key properties of 2-butan-2-yl-3-chloro-5,7-difluoro-1-benzothiophene?
2-butan-2-yl-3-chloro-5,7-difluoro-1-benzothiophene has a molecular weight of 260.74 g/mol, XLogP of 5.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-3-chloro-5,7-difluoro-1-benzothiophene is sourced from PubChem (CID 71088766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).