C17H14F3N3O2 — CID 71088878
3-[(1R,2S)-2-[6-(3,4,5-trifluorophenyl)-2,3-dihydropyridin-3-yl]cyclopropyl]imidazolidine-2,4-dione (PubChem CID 71088878) has the molecular formula C17H14F3N3O2 and a molecular weight of 349.31 g/mol. Its IUPAC name is 3-[(1R,2S)-2-[6-(3,4,5-trifluorophenyl)-2,3-dihydropyridin-3-yl]cyclopropyl]imidazolidine-2,4-dione.
| Compound Name | 3-[(1R,2S)-2-[6-(3,4,5-trifluorophenyl)-2,3-dihydropyridin-3-yl]cyclopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71088878 |
| Molecular Formula | C17H14F3N3O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 3-[(1R,2S)-2-[6-(3,4,5-trifluorophenyl)-2,3-dihydropyridin-3-yl]cyclopropyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1[C@@H]1C[C@H]1C1C=CC(c2cc(F)c(F)c(F)c2)=NC1 |
| InChI | InChI=1S/C17H14F3N3O2/c18-11-3-9(4-12(19)16(11)20)13-2-1-8(6-21-13)10-5-14(10)23-15(24)7-22-17(23)25/h1-4,8,10,14H,5-7H2,(H,22,25)/t8?,10-,14+/m0/s1 |
| InChIKey | YJSCYAQYINSLOR-CDOAYWATSA-N |
| XLogP | 2.02 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|