C29H48O2 — CID 71088901
(7S,8R,9S,13S)-5',7,9,10,13,16-hexamethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane] (PubChem CID 71088901) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is (7S,8R,9S,13S)-5',7,9,10,13,16-hexamethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane].
| Compound Name | (7S,8R,9S,13S)-5',7,9,10,13,16-hexamethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane] |
|---|---|
| PubChem CID | 71088901 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | (7S,8R,9S,13S)-5',7,9,10,13,16-hexamethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane] |
| SMILES | CC1CCC2(OC1)OC1CC3C4CCC5CC(C)CC[C@]5(C)C4CC(C)[C@]3(C)[C@H]1[C@@H]2C |
| InChI | InChI=1S/C29H48O2/c1-17-9-11-27(5)21(13-17)7-8-22-23(27)14-19(3)28(6)24(22)15-25-26(28)20(4)29(31-25)12-10-18(2)16-30-29/h17-26H,7-16H2,1-6H3/t17?,18?,19?,20-,21?,22?,23?,24?,25?,26-,27-,28-,29?/m0/s1 |
| InChIKey | FWFYLWHIIYPDEB-KJAAROAUSA-N |
| XLogP | 7.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |