C16H21NO6 — CID 71089029
(2R,6S)-10-(4-hydroxy-2-oxobutyl)-4,4-dimethyl-3,5-dioxa-10-azatetracyclo[5.5.1.02,6.08,12]tridecane-9,11-dione (PubChem CID 71089029) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2R,6S)-10-(4-hydroxy-2-oxobutyl)-4,4-dimethyl-3,5-dioxa-10-azatetracyclo[5.5.1.02,6.08,12]tridecane-9,11-dione.
| Compound Name | (2R,6S)-10-(4-hydroxy-2-oxobutyl)-4,4-dimethyl-3,5-dioxa-10-azatetracyclo[5.5.1.02,6.08,12]tridecane-9,11-dione |
|---|---|
| PubChem CID | 71089029 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (2R,6S)-10-(4-hydroxy-2-oxobutyl)-4,4-dimethyl-3,5-dioxa-10-azatetracyclo[5.5.1.02,6.08,12]tridecane-9,11-dione |
| SMILES | CC1(C)O[C@@H]2C3CC(C4C(=O)N(CC(=O)CCO)C(=O)C43)[C@@H]2O1 |
| InChI | InChI=1S/C16H21NO6/c1-16(2)22-12-8-5-9(13(12)23-16)11-10(8)14(20)17(15(11)21)6-7(19)3-4-18/h8-13,18H,3-6H2,1-2H3/t8?,9?,10?,11?,12-,13+ |
| InChIKey | HKWOLWSQWJVIDO-AALLWRQTSA-N |
| XLogP | -0.29 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|