C34H41N5O6 — CID 71089076
2-[4-[4-[[3-amino-7-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-6-methoxyquinolin-4-yl]amino]phenoxy]phenoxy]-N-methylacetamide (PubChem CID 71089076) has the molecular formula C34H41N5O6 and a molecular weight of 615.73 g/mol. Its IUPAC name is 2-[4-[4-[[3-amino-7-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-6-methoxyquinolin-4-yl]amino]phenoxy]phenoxy]-N-methylacetamide.
| Compound Name | 2-[4-[4-[[3-amino-7-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-6-methoxyquinolin-4-yl]amino]phenoxy]phenoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 71089076 |
| Molecular Formula | C34H41N5O6 |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 615.31 |
| IUPAC Name | 2-[4-[4-[[3-amino-7-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-6-methoxyquinolin-4-yl]amino]phenoxy]phenoxy]-N-methylacetamide |
| SMILES | CNC(=O)COc1ccc(Oc2ccc(Nc3c(N)cnc4cc(OCCCN5CC(C)OC(C)C5)c(OC)cc34)cc2)cc1 |
| InChI | InChI=1S/C34H41N5O6/c1-22-19-39(20-23(2)44-22)14-5-15-42-32-17-30-28(16-31(32)41-4)34(29(35)18-37-30)38-24-6-8-26(9-7-24)45-27-12-10-25(11-13-27)43-21-33(40)36-3/h6-13,16-18,22-23H,5,14-15,19-21,35H2,1-4H3,(H,36,40)(H,37,38) |
| InChIKey | FORMFBWBWJCUIB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 129.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|