About ethyl 1-(1H-indole-2-carbonyl)piperidine-4-carboxylate;1H-indole-2-carboxylic acid
ethyl 1-(1H-indole-2-carbonyl)piperidine-4-carboxylate;1H-indole-2-carboxylic acid (PubChem CID 71089865) has the molecular formula C26H27N3O5
and a molecular weight of 461.52 g/mol. Its IUPAC name is ethyl 1-(1H-indole-2-carbonyl)piperidine-4-carboxylate;1H-indole-2-carboxylic acid.
Molecular Properties
| Compound Name | ethyl 1-(1H-indole-2-carbonyl)piperidine-4-carboxylate;1H-indole-2-carboxylic acid |
| PubChem CID | 71089865 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | ethyl 1-(1H-indole-2-carbonyl)piperidine-4-carboxylate;1H-indole-2-carboxylic acid |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cc3ccccc3[nH]2)CC1.O=C(O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H20N2O3.C9H7NO2/c1-2-22-17(21)12-7-9-19(10-8-12)16(20)15-11-13-5-3-4-6-14(13)18-15;11-9(12)8-5-6-3-1-2-4-7(6)10-8/h3-6,11-12,18H,2,7-10H2,1H3;1-5,10H,(H,11,12) |
| InChIKey | DIIPWWVPNZUITE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 115.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-(1H-indole-2-carbonyl)piperidine-4-carboxylate;1H-indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(1H-indole-2-carbonyl)piperidine-4-carboxylate;1H-indole-2-carboxylic acid?
The IUPAC name of ethyl 1-(1H-indole-2-carbonyl)piperidine-4-carboxylate;1H-indole-2-carboxylic acid (CID 71089865) is ethyl 1-(1H-indole-2-carbonyl)piperidine-4-carboxylate;1H-indole-2-carboxylic acid.
What is the SMILES notation for ethyl 1-(1H-indole-2-carbonyl)piperidine-4-carboxylate;1H-indole-2-carboxylic acid?
The canonical SMILES for ethyl 1-(1H-indole-2-carbonyl)piperidine-4-carboxylate;1H-indole-2-carboxylic acid is CCOC(=O)C1CCN(C(=O)c2cc3ccccc3[nH]2)CC1.O=C(O)c1cc2ccccc2[nH]1.
What is the InChIKey of ethyl 1-(1H-indole-2-carbonyl)piperidine-4-carboxylate;1H-indole-2-carboxylic acid?
The InChIKey is DIIPWWVPNZUITE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O3.C9H7NO2/c1-2-22-17(21)12-7-9-19(10-8-12)16(20)15-11-13-5-3-4-6-14(13)18-15;11-9(12)8-5-6-3-1-2-4-7(6)10-8/h3-6,11-12,18H,2,7-10H2,1H3;1-5,10H,(H,11,12).
What are the key properties of ethyl 1-(1H-indole-2-carbonyl)piperidine-4-carboxylate;1H-indole-2-carboxylic acid?
ethyl 1-(1H-indole-2-carbonyl)piperidine-4-carboxylate;1H-indole-2-carboxylic acid has a molecular weight of 461.52 g/mol, XLogP of 4.45, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(1H-indole-2-carbonyl)piperidine-4-carboxylate;1H-indole-2-carboxylic acid is sourced from PubChem (CID 71089865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).