About thianthrene
thianthrene (PubChem CID 7109) has the molecular formula C12H8S2
and a molecular weight of 216.33 g/mol. Its IUPAC name is thianthrene.
Molecular Properties
| Compound Name | thianthrene |
| PubChem CID | 7109 |
| Molecular Formula | C12H8S2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | thianthrene |
| SMILES | c1ccc2c(c1)Sc1ccccc1S2 |
| InChI | InChI=1S/C12H8S2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-8H |
| InChIKey | GVIJJXMXTUZIOD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze thianthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thianthrene?
The IUPAC name of thianthrene (CID 7109) is thianthrene.
What is the SMILES notation for thianthrene?
The canonical SMILES for thianthrene is c1ccc2c(c1)Sc1ccccc1S2.
What is the InChIKey of thianthrene?
The InChIKey is GVIJJXMXTUZIOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-8H.
What are the key properties of thianthrene?
thianthrene has a molecular weight of 216.33 g/mol, XLogP of 4.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thianthrene is sourced from PubChem (CID 7109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).