About 2-amino-N-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]butanamide
2-amino-N-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]butanamide (PubChem CID 71090057) has the molecular formula C19H23N3O3
and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-amino-N-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]butanamide.
Molecular Properties
| Compound Name | 2-amino-N-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]butanamide |
| PubChem CID | 71090057 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-amino-N-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]butanamide |
| SMILES | CCC(N)C(=O)Nc1ccc(Oc2ccc3c(c2)C(C)(C)OC3)nc1 |
| InChI | InChI=1S/C19H23N3O3/c1-4-16(20)18(23)22-13-6-8-17(21-10-13)25-14-7-5-12-11-24-19(2,3)15(12)9-14/h5-10,16H,4,11,20H2,1-3H3,(H,22,23) |
| InChIKey | WVFINSRIJPMPGW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]butanamide?
The IUPAC name of 2-amino-N-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]butanamide (CID 71090057) is 2-amino-N-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]butanamide.
What is the SMILES notation for 2-amino-N-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]butanamide?
The canonical SMILES for 2-amino-N-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]butanamide is CCC(N)C(=O)Nc1ccc(Oc2ccc3c(c2)C(C)(C)OC3)nc1.
What is the InChIKey of 2-amino-N-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]butanamide?
The InChIKey is WVFINSRIJPMPGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O3/c1-4-16(20)18(23)22-13-6-8-17(21-10-13)25-14-7-5-12-11-24-19(2,3)15(12)9-14/h5-10,16H,4,11,20H2,1-3H3,(H,22,23).
What are the key properties of 2-amino-N-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]butanamide?
2-amino-N-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]butanamide has a molecular weight of 341.41 g/mol, XLogP of 3.32, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]butanamide is sourced from PubChem (CID 71090057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).