About N-cyclohexa-1,5-dien-1-yl-N'-phenylethane-1,2-diamine
N-cyclohexa-1,5-dien-1-yl-N'-phenylethane-1,2-diamine (PubChem CID 71090761) has the molecular formula C14H18N2
and a molecular weight of 214.31 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-N'-phenylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-cyclohexa-1,5-dien-1-yl-N'-phenylethane-1,2-diamine |
| PubChem CID | 71090761 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-N'-phenylethane-1,2-diamine |
| SMILES | C1=CC(NCCNc2ccccc2)=CCC1 |
| InChI | InChI=1S/C14H18N2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1,3-5,7-10,15-16H,2,6,11-12H2 |
| InChIKey | MCKVRSALIVIIBH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexa-1,5-dien-1-yl-N'-phenylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-1,5-dien-1-yl-N'-phenylethane-1,2-diamine?
The IUPAC name of N-cyclohexa-1,5-dien-1-yl-N'-phenylethane-1,2-diamine (CID 71090761) is N-cyclohexa-1,5-dien-1-yl-N'-phenylethane-1,2-diamine.
What is the SMILES notation for N-cyclohexa-1,5-dien-1-yl-N'-phenylethane-1,2-diamine?
The canonical SMILES for N-cyclohexa-1,5-dien-1-yl-N'-phenylethane-1,2-diamine is C1=CC(NCCNc2ccccc2)=CCC1.
What is the InChIKey of N-cyclohexa-1,5-dien-1-yl-N'-phenylethane-1,2-diamine?
The InChIKey is MCKVRSALIVIIBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1,3-5,7-10,15-16H,2,6,11-12H2.
What are the key properties of N-cyclohexa-1,5-dien-1-yl-N'-phenylethane-1,2-diamine?
N-cyclohexa-1,5-dien-1-yl-N'-phenylethane-1,2-diamine has a molecular weight of 214.31 g/mol, XLogP of 2.92, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-1,5-dien-1-yl-N'-phenylethane-1,2-diamine is sourced from PubChem (CID 71090761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).