About 1-cyclohexa-1,3-dien-1-yl-2-(3-methylphenyl)-3a,7a-dihydrobenzimidazole
1-cyclohexa-1,3-dien-1-yl-2-(3-methylphenyl)-3a,7a-dihydrobenzimidazole (PubChem CID 71090933) has the molecular formula C20H20N2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-2-(3-methylphenyl)-3a,7a-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-2-(3-methylphenyl)-3a,7a-dihydrobenzimidazole |
| PubChem CID | 71090933 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-2-(3-methylphenyl)-3a,7a-dihydrobenzimidazole |
| SMILES | Cc1cccc(C2=NC3C=CC=CC3N2C2=CC=CCC2)c1 |
| InChI | InChI=1S/C20H20N2/c1-15-8-7-9-16(14-15)20-21-18-12-5-6-13-19(18)22(20)17-10-3-2-4-11-17/h2-3,5-10,12-14,18-19H,4,11H2,1H3 |
| InChIKey | ZQZDOUQEWDXYEG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexa-1,3-dien-1-yl-2-(3-methylphenyl)-3a,7a-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,3-dien-1-yl-2-(3-methylphenyl)-3a,7a-dihydrobenzimidazole?
The IUPAC name of 1-cyclohexa-1,3-dien-1-yl-2-(3-methylphenyl)-3a,7a-dihydrobenzimidazole (CID 71090933) is 1-cyclohexa-1,3-dien-1-yl-2-(3-methylphenyl)-3a,7a-dihydrobenzimidazole.
What is the SMILES notation for 1-cyclohexa-1,3-dien-1-yl-2-(3-methylphenyl)-3a,7a-dihydrobenzimidazole?
The canonical SMILES for 1-cyclohexa-1,3-dien-1-yl-2-(3-methylphenyl)-3a,7a-dihydrobenzimidazole is Cc1cccc(C2=NC3C=CC=CC3N2C2=CC=CCC2)c1.
What is the InChIKey of 1-cyclohexa-1,3-dien-1-yl-2-(3-methylphenyl)-3a,7a-dihydrobenzimidazole?
The InChIKey is ZQZDOUQEWDXYEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2/c1-15-8-7-9-16(14-15)20-21-18-12-5-6-13-19(18)22(20)17-10-3-2-4-11-17/h2-3,5-10,12-14,18-19H,4,11H2,1H3.
What are the key properties of 1-cyclohexa-1,3-dien-1-yl-2-(3-methylphenyl)-3a,7a-dihydrobenzimidazole?
1-cyclohexa-1,3-dien-1-yl-2-(3-methylphenyl)-3a,7a-dihydrobenzimidazole has a molecular weight of 288.39 g/mol, XLogP of 4.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,3-dien-1-yl-2-(3-methylphenyl)-3a,7a-dihydrobenzimidazole is sourced from PubChem (CID 71090933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).