About 3a,7a-dimethyl-2-(4-methylphenyl)-1,3-benzothiazole
3a,7a-dimethyl-2-(4-methylphenyl)-1,3-benzothiazole (PubChem CID 71090967) has the molecular formula C16H17NS
and a molecular weight of 255.39 g/mol. Its IUPAC name is 3a,7a-dimethyl-2-(4-methylphenyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 3a,7a-dimethyl-2-(4-methylphenyl)-1,3-benzothiazole |
| PubChem CID | 71090967 |
| Molecular Formula | C16H17NS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 3a,7a-dimethyl-2-(4-methylphenyl)-1,3-benzothiazole |
| SMILES | Cc1ccc(C2=NC3(C)C=CC=CC3(C)S2)cc1 |
| InChI | InChI=1S/C16H17NS/c1-12-6-8-13(9-7-12)14-17-15(2)10-4-5-11-16(15,3)18-14/h4-11H,1-3H3 |
| InChIKey | MUBQTNDFSZLGQI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3a,7a-dimethyl-2-(4-methylphenyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,7a-dimethyl-2-(4-methylphenyl)-1,3-benzothiazole?
The IUPAC name of 3a,7a-dimethyl-2-(4-methylphenyl)-1,3-benzothiazole (CID 71090967) is 3a,7a-dimethyl-2-(4-methylphenyl)-1,3-benzothiazole.
What is the SMILES notation for 3a,7a-dimethyl-2-(4-methylphenyl)-1,3-benzothiazole?
The canonical SMILES for 3a,7a-dimethyl-2-(4-methylphenyl)-1,3-benzothiazole is Cc1ccc(C2=NC3(C)C=CC=CC3(C)S2)cc1.
What is the InChIKey of 3a,7a-dimethyl-2-(4-methylphenyl)-1,3-benzothiazole?
The InChIKey is MUBQTNDFSZLGQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NS/c1-12-6-8-13(9-7-12)14-17-15(2)10-4-5-11-16(15,3)18-14/h4-11H,1-3H3.
What are the key properties of 3a,7a-dimethyl-2-(4-methylphenyl)-1,3-benzothiazole?
3a,7a-dimethyl-2-(4-methylphenyl)-1,3-benzothiazole has a molecular weight of 255.39 g/mol, XLogP of 4.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,7a-dimethyl-2-(4-methylphenyl)-1,3-benzothiazole is sourced from PubChem (CID 71090967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).