C18H37N — CID 71091409
4,5-diethyl-1,2,2,6,8,8-hexamethylazonane (PubChem CID 71091409) has the molecular formula C18H37N and a molecular weight of 267.50 g/mol. Its IUPAC name is 4,5-diethyl-1,2,2,6,8,8-hexamethylazonane.
| Compound Name | 4,5-diethyl-1,2,2,6,8,8-hexamethylazonane |
|---|---|
| PubChem CID | 71091409 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | 4,5-diethyl-1,2,2,6,8,8-hexamethylazonane |
| SMILES | CCC1CC(C)(C)N(C)CC(C)(C)CC(C)C1CC |
| InChI | InChI=1S/C18H37N/c1-9-15-12-18(6,7)19(8)13-17(4,5)11-14(3)16(15)10-2/h14-16H,9-13H2,1-8H3 |
| InChIKey | MHOGWYWKDFXQJM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |