C30H44N4O5 — CID 71091792
N-cycloheptyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-(4-methyl-3,4-dihydropyridin-6-yl)ethoxy]propanamide (PubChem CID 71091792) has the molecular formula C30H44N4O5 and a molecular weight of 540.71 g/mol. Its IUPAC name is N-cycloheptyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-(4-methyl-3,4-dihydropyridin-6-yl)ethoxy]propanamide.
| Compound Name | N-cycloheptyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-(4-methyl-3,4-dihydropyridin-6-yl)ethoxy]propanamide |
|---|---|
| PubChem CID | 71091792 |
| Molecular Formula | C30H44N4O5 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | N-cycloheptyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-(4-methyl-3,4-dihydropyridin-6-yl)ethoxy]propanamide |
| SMILES | CC1C=C(CCOCCC(=O)N(CCNCCc2ccc(O)c3c2OCC(=O)N3)C2CCCCCC2)N=CC1 |
| InChI | InChI=1S/C30H44N4O5/c1-22-10-15-32-24(20-22)12-18-38-19-13-28(37)34(25-6-4-2-3-5-7-25)17-16-31-14-11-23-8-9-26(35)29-30(23)39-21-27(36)33-29/h8-9,15,20,22,25,31,35H,2-7,10-14,16-19,21H2,1H3,(H,33,36) |
| InChIKey | LWGJLUJCQSRWDX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|