C15H31N3 — CID 71092215
1-N-cycloprop-2-en-1-yl-1-N',1-N',1-N",1-N"-tetraethylbutane-1,1,1-triamine (PubChem CID 71092215) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is 1-N-cycloprop-2-en-1-yl-1-N',1-N',1-N",1-N"-tetraethylbutane-1,1,1-triamine.
| Compound Name | 1-N-cycloprop-2-en-1-yl-1-N',1-N',1-N",1-N"-tetraethylbutane-1,1,1-triamine |
|---|---|
| PubChem CID | 71092215 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 1-N-cycloprop-2-en-1-yl-1-N',1-N',1-N",1-N"-tetraethylbutane-1,1,1-triamine |
| SMILES | CCCC(NC1C=C1)(N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C15H31N3/c1-6-13-15(16-14-11-12-14,17(7-2)8-3)18(9-4)10-5/h11-12,14,16H,6-10,13H2,1-5H3 |
| InChIKey | CDEDPDVCIAMQJX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|