C38H44N4O7 — CID 71093315
3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonylamino]-phenylmethyl]-5-[5-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]pentyl]benzoic acid (PubChem CID 71093315) has the molecular formula C38H44N4O7 and a molecular weight of 668.79 g/mol. Its IUPAC name is 3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonylamino]-phenylmethyl]-5-[5-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]pentyl]benzoic acid.
| Compound Name | 3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonylamino]-phenylmethyl]-5-[5-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]pentyl]benzoic acid |
|---|---|
| PubChem CID | 71093315 |
| Molecular Formula | C38H44N4O7 |
| Molecular Weight | 668.79 g/mol |
| Exact Mass | 668.32 |
| IUPAC Name | 3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonylamino]-phenylmethyl]-5-[5-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]pentyl]benzoic acid |
| SMILES | O=C(NC(c1ccccc1)c1cc(CCCCCNC[C@H](O)c2ccc(O)c3[nH]c(=O)ccc23)cc(C(=O)O)c1)O[C@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C38H44N4O7/c43-31-12-10-29(30-11-13-34(45)40-36(30)31)32(44)22-39-16-6-2-3-7-24-19-27(21-28(20-24)37(46)47)35(26-8-4-1-5-9-26)41-38(48)49-33-23-42-17-14-25(33)15-18-42/h1,4-5,8-13,19-21,25,32-33,35,39,43-44H,2-3,6-7,14-18,22-23H2,(H,40,45)(H,41,48)(H,46,47)/t32-,33-,35?/m0/s1 |
| InChIKey | DDAMDAFBLZZFOU-HEVKVOQNSA-N |
| XLogP | 4.88 |
| TPSA | 164.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.79 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|