C19H22ClN3O2 — CID 71093600
6-(4-chlorophenyl)-N-[3-(methylcarbamoyl)pentan-3-yl]pyridine-2-carboxamide (PubChem CID 71093600) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-[3-(methylcarbamoyl)pentan-3-yl]pyridine-2-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-N-[3-(methylcarbamoyl)pentan-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71093600 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 6-(4-chlorophenyl)-N-[3-(methylcarbamoyl)pentan-3-yl]pyridine-2-carboxamide |
| SMILES | CCC(CC)(NC(=O)c1cccc(-c2ccc(Cl)cc2)n1)C(=O)NC |
| InChI | InChI=1S/C19H22ClN3O2/c1-4-19(5-2,18(25)21-3)23-17(24)16-8-6-7-15(22-16)13-9-11-14(20)12-10-13/h6-12H,4-5H2,1-3H3,(H,21,25)(H,23,24) |
| InChIKey | YQBCNOJHSPFHPI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |