C20H38O4Si — CID 71095201
(4R,9E,11S)-7-methoxy-7,11-dimethyl-4-triethylsilyloxy-1-oxacyclododec-9-en-2-one (PubChem CID 71095201) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is (4R,9E,11S)-7-methoxy-7,11-dimethyl-4-triethylsilyloxy-1-oxacyclododec-9-en-2-one.
| Compound Name | (4R,9E,11S)-7-methoxy-7,11-dimethyl-4-triethylsilyloxy-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 71095201 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (4R,9E,11S)-7-methoxy-7,11-dimethyl-4-triethylsilyloxy-1-oxacyclododec-9-en-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1CCC(C)(OC)C/C=C/[C@H](C)COC(=O)C1 |
| InChI | InChI=1S/C20H38O4Si/c1-7-25(8-2,9-3)24-18-12-14-20(5,22-6)13-10-11-17(4)16-23-19(21)15-18/h10-11,17-18H,7-9,12-16H2,1-6H3/b11-10+/t17-,18+,20?/m0/s1 |
| InChIKey | GBVZUZRIWSITLS-DNCQADQUSA-N |
| XLogP | 5.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|