C15H27NO8 — CID 71095781
N-[(E,2S,3R)-3-hydroxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhex-4-en-2-yl]propanamide (PubChem CID 71095781) has the molecular formula C15H27NO8 and a molecular weight of 349.38 g/mol. Its IUPAC name is N-[(E,2S,3R)-3-hydroxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhex-4-en-2-yl]propanamide.
| Compound Name | N-[(E,2S,3R)-3-hydroxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhex-4-en-2-yl]propanamide |
|---|---|
| PubChem CID | 71095781 |
| Molecular Formula | C15H27NO8 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-[(E,2S,3R)-3-hydroxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhex-4-en-2-yl]propanamide |
| SMILES | C/C=C/[C@@H](O)[C@H](CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)NC(=O)CC |
| InChI | InChI=1S/C15H27NO8/c1-3-5-9(18)8(16-11(19)4-2)7-23-15-14(22)13(21)12(20)10(6-17)24-15/h3,5,8-10,12-15,17-18,20-22H,4,6-7H2,1-2H3,(H,16,19)/b5-3+/t8-,9+,10+,12-,13-,14+,15+/m0/s1 |
| InChIKey | BWLBIMUQCJUHMS-PVQHJAJMSA-N |
| XLogP | -2.37 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|