About 10-(2-methylsulfanylethylsulfanyl)tricyclo[5.2.1.02,6]decane
10-(2-methylsulfanylethylsulfanyl)tricyclo[5.2.1.02,6]decane (PubChem CID 71095799) has the molecular formula C13H22S2
and a molecular weight of 242.45 g/mol. Its IUPAC name is 10-(2-methylsulfanylethylsulfanyl)tricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | 10-(2-methylsulfanylethylsulfanyl)tricyclo[5.2.1.02,6]decane |
| PubChem CID | 71095799 |
| Molecular Formula | C13H22S2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 10-(2-methylsulfanylethylsulfanyl)tricyclo[5.2.1.02,6]decane |
| SMILES | CSCCSC1C2CCC1C1CCCC12 |
| InChI | InChI=1S/C13H22S2/c1-14-7-8-15-13-11-5-6-12(13)10-4-2-3-9(10)11/h9-13H,2-8H2,1H3 |
| InChIKey | VXJDRSWKOQFWCP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-(2-methylsulfanylethylsulfanyl)tricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(2-methylsulfanylethylsulfanyl)tricyclo[5.2.1.02,6]decane?
The IUPAC name of 10-(2-methylsulfanylethylsulfanyl)tricyclo[5.2.1.02,6]decane (CID 71095799) is 10-(2-methylsulfanylethylsulfanyl)tricyclo[5.2.1.02,6]decane.
What is the SMILES notation for 10-(2-methylsulfanylethylsulfanyl)tricyclo[5.2.1.02,6]decane?
The canonical SMILES for 10-(2-methylsulfanylethylsulfanyl)tricyclo[5.2.1.02,6]decane is CSCCSC1C2CCC1C1CCCC12.
What is the InChIKey of 10-(2-methylsulfanylethylsulfanyl)tricyclo[5.2.1.02,6]decane?
The InChIKey is VXJDRSWKOQFWCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22S2/c1-14-7-8-15-13-11-5-6-12(13)10-4-2-3-9(10)11/h9-13H,2-8H2,1H3.
What are the key properties of 10-(2-methylsulfanylethylsulfanyl)tricyclo[5.2.1.02,6]decane?
10-(2-methylsulfanylethylsulfanyl)tricyclo[5.2.1.02,6]decane has a molecular weight of 242.45 g/mol, XLogP of 3.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(2-methylsulfanylethylsulfanyl)tricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 71095799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).