C16H26N4O4 — CID 71096049
1-O-tert-butyl 2-O-methyl (2S)-5-(3-azidopropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate (PubChem CID 71096049) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S)-5-(3-azidopropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S)-5-(3-azidopropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 71096049 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S)-5-(3-azidopropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC=C(CCCN=[N+]=[N-])CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26N4O4/c1-16(2,3)24-15(22)20-11-9-12(6-5-10-18-19-17)7-8-13(20)14(21)23-4/h7,13H,5-6,8-11H2,1-4H3/t13-/m0/s1 |
| InChIKey | UEUOWOVXNCDVFM-ZDUSSCGKSA-N |
| XLogP | 3.58 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|