C21H26N4O3 — CID 71096050
(9R,10R)-9-hydroxy-10-[1-(6-oxo-1H-pyridin-2-yl)pentan-3-ylamino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one (PubChem CID 71096050) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is (9R,10R)-9-hydroxy-10-[1-(6-oxo-1H-pyridin-2-yl)pentan-3-ylamino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one.
| Compound Name | (9R,10R)-9-hydroxy-10-[1-(6-oxo-1H-pyridin-2-yl)pentan-3-ylamino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
|---|---|
| PubChem CID | 71096050 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (9R,10R)-9-hydroxy-10-[1-(6-oxo-1H-pyridin-2-yl)pentan-3-ylamino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
| SMILES | CCC(CCc1cccc(=O)[nH]1)N[C@@H]1CCn2c(=O)[nH]c3cccc(c32)[C@H]1O |
| InChI | InChI=1S/C21H26N4O3/c1-2-13(9-10-14-5-3-8-18(26)23-14)22-17-11-12-25-19-15(20(17)27)6-4-7-16(19)24-21(25)28/h3-8,13,17,20,22,27H,2,9-12H2,1H3,(H,23,26)(H,24,28)/t13?,17-,20-/m1/s1 |
| InChIKey | IJLJQZRTQHVLCP-UNHSHWACSA-N |
| XLogP | 1.82 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |