C23H20ClFN6 — CID 71096226
6-(3-chloro-4-fluorophenyl)-N-(4-piperazin-1-ylphenyl)-1,2,4-benzotriazin-3-amine (PubChem CID 71096226) has the molecular formula C23H20ClFN6 and a molecular weight of 434.91 g/mol. Its IUPAC name is 6-(3-chloro-4-fluorophenyl)-N-(4-piperazin-1-ylphenyl)-1,2,4-benzotriazin-3-amine.
| Compound Name | 6-(3-chloro-4-fluorophenyl)-N-(4-piperazin-1-ylphenyl)-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 71096226 |
| Molecular Formula | C23H20ClFN6 |
| Molecular Weight | 434.91 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 6-(3-chloro-4-fluorophenyl)-N-(4-piperazin-1-ylphenyl)-1,2,4-benzotriazin-3-amine |
| SMILES | Fc1ccc(-c2ccc3nnc(Nc4ccc(N5CCNCC5)cc4)nc3c2)cc1Cl |
| InChI | InChI=1S/C23H20ClFN6/c24-19-13-15(1-7-20(19)25)16-2-8-21-22(14-16)28-23(30-29-21)27-17-3-5-18(6-4-17)31-11-9-26-10-12-31/h1-8,13-14,26H,9-12H2,(H,27,28,30) |
| InChIKey | ICBUHGNOURWUDA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.91 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|