C22H35N — CID 71096929
(4S)-4,5-dimethyl-N-(4-methylcyclohexen-1-yl)-N-(4-methylcyclohex-3-en-1-yl)cyclohex-2-en-1-amine (PubChem CID 71096929) has the molecular formula C22H35N and a molecular weight of 313.53 g/mol. Its IUPAC name is (4S)-4,5-dimethyl-N-(4-methylcyclohexen-1-yl)-N-(4-methylcyclohex-3-en-1-yl)cyclohex-2-en-1-amine.
| Compound Name | (4S)-4,5-dimethyl-N-(4-methylcyclohexen-1-yl)-N-(4-methylcyclohex-3-en-1-yl)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 71096929 |
| Molecular Formula | C22H35N |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | (4S)-4,5-dimethyl-N-(4-methylcyclohexen-1-yl)-N-(4-methylcyclohex-3-en-1-yl)cyclohex-2-en-1-amine |
| SMILES | CC1=CCC(N(C2=CCC(C)CC2)C2C=C[C@@H](C)C(C)C2)CC1 |
| InChI | InChI=1S/C22H35N/c1-16-5-10-20(11-6-16)23(21-12-7-17(2)8-13-21)22-14-9-18(3)19(4)15-22/h5,9,12,14,17-20,22H,6-8,10-11,13,15H2,1-4H3/t17?,18-,19?,20?,22?/m1/s1 |
| InChIKey | AHLXHMKLTQWSAD-RWAPRYRQSA-N |
| XLogP | 6.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|