C14H26N2O2 — CID 71096968
(2R,3R)-3-(3-aminooxycyclohexa-1,3-dien-1-yl)-1-(dimethylamino)-2-methylpentan-3-ol (PubChem CID 71096968) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is (2R,3R)-3-(3-aminooxycyclohexa-1,3-dien-1-yl)-1-(dimethylamino)-2-methylpentan-3-ol.
| Compound Name | (2R,3R)-3-(3-aminooxycyclohexa-1,3-dien-1-yl)-1-(dimethylamino)-2-methylpentan-3-ol |
|---|---|
| PubChem CID | 71096968 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | (2R,3R)-3-(3-aminooxycyclohexa-1,3-dien-1-yl)-1-(dimethylamino)-2-methylpentan-3-ol |
| SMILES | CC[C@](O)(C1=CC(ON)=CCC1)[C@H](C)CN(C)C |
| InChI | InChI=1S/C14H26N2O2/c1-5-14(17,11(2)10-16(3)4)12-7-6-8-13(9-12)18-15/h8-9,11,17H,5-7,10,15H2,1-4H3/t11-,14-/m1/s1 |
| InChIKey | QCYDJMNNPDQMPK-BXUZGUMPSA-N |
| XLogP | 1.82 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|