About N-butyl-3,3-dimethyl-N-[4-(trifluoromethoxy)pyrimidin-2-yl]butanamide
N-butyl-3,3-dimethyl-N-[4-(trifluoromethoxy)pyrimidin-2-yl]butanamide (PubChem CID 71097024) has the molecular formula C15H22F3N3O2
and a molecular weight of 333.35 g/mol. Its IUPAC name is N-butyl-3,3-dimethyl-N-[4-(trifluoromethoxy)pyrimidin-2-yl]butanamide.
Molecular Properties
| Compound Name | N-butyl-3,3-dimethyl-N-[4-(trifluoromethoxy)pyrimidin-2-yl]butanamide |
| PubChem CID | 71097024 |
| Molecular Formula | C15H22F3N3O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-butyl-3,3-dimethyl-N-[4-(trifluoromethoxy)pyrimidin-2-yl]butanamide |
| SMILES | CCCCN(C(=O)CC(C)(C)C)c1nccc(OC(F)(F)F)n1 |
| InChI | InChI=1S/C15H22F3N3O2/c1-5-6-9-21(12(22)10-14(2,3)4)13-19-8-7-11(20-13)23-15(16,17)18/h7-8H,5-6,9-10H2,1-4H3 |
| InChIKey | ZXUYYIGIGTYBFF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butyl-3,3-dimethyl-N-[4-(trifluoromethoxy)pyrimidin-2-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-3,3-dimethyl-N-[4-(trifluoromethoxy)pyrimidin-2-yl]butanamide?
The IUPAC name of N-butyl-3,3-dimethyl-N-[4-(trifluoromethoxy)pyrimidin-2-yl]butanamide (CID 71097024) is N-butyl-3,3-dimethyl-N-[4-(trifluoromethoxy)pyrimidin-2-yl]butanamide.
What is the SMILES notation for N-butyl-3,3-dimethyl-N-[4-(trifluoromethoxy)pyrimidin-2-yl]butanamide?
The canonical SMILES for N-butyl-3,3-dimethyl-N-[4-(trifluoromethoxy)pyrimidin-2-yl]butanamide is CCCCN(C(=O)CC(C)(C)C)c1nccc(OC(F)(F)F)n1.
What is the InChIKey of N-butyl-3,3-dimethyl-N-[4-(trifluoromethoxy)pyrimidin-2-yl]butanamide?
The InChIKey is ZXUYYIGIGTYBFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22F3N3O2/c1-5-6-9-21(12(22)10-14(2,3)4)13-19-8-7-11(20-13)23-15(16,17)18/h7-8H,5-6,9-10H2,1-4H3.
What are the key properties of N-butyl-3,3-dimethyl-N-[4-(trifluoromethoxy)pyrimidin-2-yl]butanamide?
N-butyl-3,3-dimethyl-N-[4-(trifluoromethoxy)pyrimidin-2-yl]butanamide has a molecular weight of 333.35 g/mol, XLogP of 3.94, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-3,3-dimethyl-N-[4-(trifluoromethoxy)pyrimidin-2-yl]butanamide is sourced from PubChem (CID 71097024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).