C20H18N3O2- — CID 7109734
(1R,16R)-16,19,19-trimethyl-3,9,14-triazapentacyclo[14.2.1.02,15.04,13.05,10]nonadeca-2,4(13),5(10),6,8,11,14-heptaene-1-carboxylate (PubChem CID 7109734) has the molecular formula C20H18N3O2- and a molecular weight of 332.38 g/mol. Its IUPAC name is (1R,16R)-16,19,19-trimethyl-3,9,14-triazapentacyclo[14.2.1.02,15.04,13.05,10]nonadeca-2,4(13),5(10),6,8,11,14-heptaene-1-carboxylate.
| Compound Name | (1R,16R)-16,19,19-trimethyl-3,9,14-triazapentacyclo[14.2.1.02,15.04,13.05,10]nonadeca-2,4(13),5(10),6,8,11,14-heptaene-1-carboxylate |
|---|---|
| PubChem CID | 7109734 |
| Molecular Formula | C20H18N3O2- |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (1R,16R)-16,19,19-trimethyl-3,9,14-triazapentacyclo[14.2.1.02,15.04,13.05,10]nonadeca-2,4(13),5(10),6,8,11,14-heptaene-1-carboxylate |
| SMILES | CC1(C)[C@@]2(C)CC[C@]1(C(=O)[O-])c1nc3c(ccc4ncccc43)nc12 |
| InChI | InChI=1S/C20H19N3O2/c1-18(2)19(3)8-9-20(18,17(24)25)16-15(19)22-13-7-6-12-11(14(13)23-16)5-4-10-21-12/h4-7,10H,8-9H2,1-3H3,(H,24,25)/p-1/t19-,20+/m0/s1 |
| InChIKey | HJEBEUGQKNPSKR-VQTJNVASSA-M |
| XLogP | 2.26 |
| TPSA | 78.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|