About (2S)-4-(4-fluorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate
(2S)-4-(4-fluorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate (PubChem CID 7109742) has the molecular formula C16H11FNO2S-
and a molecular weight of 300.33 g/mol. Its IUPAC name is (2S)-4-(4-fluorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate.
Molecular Properties
| Compound Name | (2S)-4-(4-fluorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate |
| PubChem CID | 7109742 |
| Molecular Formula | C16H11FNO2S- |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | (2S)-4-(4-fluorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1CC(c2ccc(F)cc2)=Nc2ccccc2S1 |
| InChI | InChI=1S/C16H12FNO2S/c17-11-7-5-10(6-8-11)13-9-15(16(19)20)21-14-4-2-1-3-12(14)18-13/h1-8,15H,9H2,(H,19,20)/p-1/t15-/m0/s1 |
| InChIKey | HYRNGOMMJVNASV-HNNXBMFYSA-M |
| XLogP | 2.56 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-4-(4-fluorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-(4-fluorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate?
The IUPAC name of (2S)-4-(4-fluorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate (CID 7109742) is (2S)-4-(4-fluorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate.
What is the SMILES notation for (2S)-4-(4-fluorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate?
The canonical SMILES for (2S)-4-(4-fluorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate is O=C([O-])[C@@H]1CC(c2ccc(F)cc2)=Nc2ccccc2S1.
What is the InChIKey of (2S)-4-(4-fluorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate?
The InChIKey is HYRNGOMMJVNASV-HNNXBMFYSA-M. The full InChI is InChI=1S/C16H12FNO2S/c17-11-7-5-10(6-8-11)13-9-15(16(19)20)21-14-4-2-1-3-12(14)18-13/h1-8,15H,9H2,(H,19,20)/p-1/t15-/m0/s1.
What are the key properties of (2S)-4-(4-fluorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate?
(2S)-4-(4-fluorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate has a molecular weight of 300.33 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-(4-fluorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate is sourced from PubChem (CID 7109742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).