C10H19BrO2 — CID 7109758
[(1R,2R,3S)-2-(bromomethyl)-3-(hydroxymethyl)-2,3-dimethylcyclopentyl]methanol (PubChem CID 7109758) has the molecular formula C10H19BrO2 and a molecular weight of 251.16 g/mol. Its IUPAC name is [(1R,2R,3S)-2-(bromomethyl)-3-(hydroxymethyl)-2,3-dimethylcyclopentyl]methanol.
| Compound Name | [(1R,2R,3S)-2-(bromomethyl)-3-(hydroxymethyl)-2,3-dimethylcyclopentyl]methanol |
|---|---|
| PubChem CID | 7109758 |
| Molecular Formula | C10H19BrO2 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | [(1R,2R,3S)-2-(bromomethyl)-3-(hydroxymethyl)-2,3-dimethylcyclopentyl]methanol |
| SMILES | C[C@]1(CO)CC[C@@H](CO)[C@@]1(C)CBr |
| InChI | InChI=1S/C10H19BrO2/c1-9(7-13)4-3-8(5-12)10(9,2)6-11/h8,12-13H,3-7H2,1-2H3/t8-,9+,10+/m0/s1 |
| InChIKey | YNMYGKIFOPCRMB-IVZWLZJFSA-N |
| XLogP | 1.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|