C25H36O2S — CID 71098095
ethyl (4Z,7Z,10Z)-11-[1-[(Z)-but-1-enyl]cyclohexa-2,5-dien-1-yl]-2-ethylsulfanylundeca-4,7,10-trienoate (PubChem CID 71098095) has the molecular formula C25H36O2S and a molecular weight of 400.63 g/mol. Its IUPAC name is ethyl (4Z,7Z,10Z)-11-[1-[(Z)-but-1-enyl]cyclohexa-2,5-dien-1-yl]-2-ethylsulfanylundeca-4,7,10-trienoate.
| Compound Name | ethyl (4Z,7Z,10Z)-11-[1-[(Z)-but-1-enyl]cyclohexa-2,5-dien-1-yl]-2-ethylsulfanylundeca-4,7,10-trienoate |
|---|---|
| PubChem CID | 71098095 |
| Molecular Formula | C25H36O2S |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | ethyl (4Z,7Z,10Z)-11-[1-[(Z)-but-1-enyl]cyclohexa-2,5-dien-1-yl]-2-ethylsulfanylundeca-4,7,10-trienoate |
| SMILES | CC/C=C\C1(/C=C\C/C=C\C/C=C\CC(SCC)C(=O)OCC)C=CCC=C1 |
| InChI | InChI=1S/C25H36O2S/c1-4-7-19-25(21-16-13-17-22-25)20-15-12-10-8-9-11-14-18-23(28-6-3)24(26)27-5-2/h7-8,10-11,14-17,19-23H,4-6,9,12-13,18H2,1-3H3/b10-8-,14-11-,19-7-,20-15- |
| InChIKey | UUTGSVNHNLDBAU-ZABMCVDOSA-N |
| XLogP | 6.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|