C23H34O3 — CID 71098257
ethyl (Z)-2-ethoxy-6-[(5Z,8Z,11Z)-1-methylcyclododeca-2,5,8,11-tetraen-1-yl]hex-5-enoate (PubChem CID 71098257) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is ethyl (Z)-2-ethoxy-6-[(5Z,8Z,11Z)-1-methylcyclododeca-2,5,8,11-tetraen-1-yl]hex-5-enoate.
| Compound Name | ethyl (Z)-2-ethoxy-6-[(5Z,8Z,11Z)-1-methylcyclododeca-2,5,8,11-tetraen-1-yl]hex-5-enoate |
|---|---|
| PubChem CID | 71098257 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | ethyl (Z)-2-ethoxy-6-[(5Z,8Z,11Z)-1-methylcyclododeca-2,5,8,11-tetraen-1-yl]hex-5-enoate |
| SMILES | CCOC(=O)C(CC/C=C\C1(C)C=CC/C=C\C/C=C\C/C=C\1)OCC |
| InChI | InChI=1S/C23H34O3/c1-4-25-21(22(24)26-5-2)17-13-16-20-23(3)18-14-11-9-7-6-8-10-12-15-19-23/h7-10,14-16,18-21H,4-6,11-13,17H2,1-3H3/b9-7-,10-8-,18-14-,19-15?,20-16- |
| InChIKey | RXUKJDYEYCNQND-UVZANTPDSA-N |
| XLogP | 5.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|