C21H28O2S — CID 71098287
ethyl (Z)-6-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)-2-methylsulfanylhex-5-enoate (PubChem CID 71098287) has the molecular formula C21H28O2S and a molecular weight of 344.52 g/mol. Its IUPAC name is ethyl (Z)-6-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)-2-methylsulfanylhex-5-enoate.
| Compound Name | ethyl (Z)-6-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)-2-methylsulfanylhex-5-enoate |
|---|---|
| PubChem CID | 71098287 |
| Molecular Formula | C21H28O2S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | ethyl (Z)-6-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)-2-methylsulfanylhex-5-enoate |
| SMILES | CCOC(=O)C(CC/C=C\C1(C)C=CC2(C=CCC=C2)C=C1)SC |
| InChI | InChI=1S/C21H28O2S/c1-4-23-19(22)18(24-3)10-6-9-11-20(2)14-16-21(17-15-20)12-7-5-8-13-21/h7-9,11-18H,4-6,10H2,1-3H3/b11-9- |
| InChIKey | MLNUEZPCRYCYRJ-LUAWRHEFSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|