About methyl 2-[4-(2-fluoro-2-methylpropyl)cyclohexa-1,5-dien-1-yl]propanoate
methyl 2-[4-(2-fluoro-2-methylpropyl)cyclohexa-1,5-dien-1-yl]propanoate (PubChem CID 71098397) has the molecular formula C14H21FO2
and a molecular weight of 240.32 g/mol. Its IUPAC name is methyl 2-[4-(2-fluoro-2-methylpropyl)cyclohexa-1,5-dien-1-yl]propanoate.
Molecular Properties
| Compound Name | methyl 2-[4-(2-fluoro-2-methylpropyl)cyclohexa-1,5-dien-1-yl]propanoate |
| PubChem CID | 71098397 |
| Molecular Formula | C14H21FO2 |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | methyl 2-[4-(2-fluoro-2-methylpropyl)cyclohexa-1,5-dien-1-yl]propanoate |
| SMILES | COC(=O)C(C)C1=CCC(CC(C)(C)F)C=C1 |
| InChI | InChI=1S/C14H21FO2/c1-10(13(16)17-4)12-7-5-11(6-8-12)9-14(2,3)15/h5,7-8,10-11H,6,9H2,1-4H3 |
| InChIKey | GTPPTXZMTWSSJD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 2-[4-(2-fluoro-2-methylpropyl)cyclohexa-1,5-dien-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-(2-fluoro-2-methylpropyl)cyclohexa-1,5-dien-1-yl]propanoate?
The IUPAC name of methyl 2-[4-(2-fluoro-2-methylpropyl)cyclohexa-1,5-dien-1-yl]propanoate (CID 71098397) is methyl 2-[4-(2-fluoro-2-methylpropyl)cyclohexa-1,5-dien-1-yl]propanoate.
What is the SMILES notation for methyl 2-[4-(2-fluoro-2-methylpropyl)cyclohexa-1,5-dien-1-yl]propanoate?
The canonical SMILES for methyl 2-[4-(2-fluoro-2-methylpropyl)cyclohexa-1,5-dien-1-yl]propanoate is COC(=O)C(C)C1=CCC(CC(C)(C)F)C=C1.
What is the InChIKey of methyl 2-[4-(2-fluoro-2-methylpropyl)cyclohexa-1,5-dien-1-yl]propanoate?
The InChIKey is GTPPTXZMTWSSJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21FO2/c1-10(13(16)17-4)12-7-5-11(6-8-12)9-14(2,3)15/h5,7-8,10-11H,6,9H2,1-4H3.
What are the key properties of methyl 2-[4-(2-fluoro-2-methylpropyl)cyclohexa-1,5-dien-1-yl]propanoate?
methyl 2-[4-(2-fluoro-2-methylpropyl)cyclohexa-1,5-dien-1-yl]propanoate has a molecular weight of 240.32 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-(2-fluoro-2-methylpropyl)cyclohexa-1,5-dien-1-yl]propanoate is sourced from PubChem (CID 71098397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).