C23H32O3 — CID 71098434
ethyl (E)-6-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)-2-propoxyhex-4-enoate (PubChem CID 71098434) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is ethyl (E)-6-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)-2-propoxyhex-4-enoate.
| Compound Name | ethyl (E)-6-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)-2-propoxyhex-4-enoate |
|---|---|
| PubChem CID | 71098434 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | ethyl (E)-6-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)-2-propoxyhex-4-enoate |
| SMILES | CCCOC(C/C=C/CC1(C)C=CC2(C=CCC=C2)C=C1)C(=O)OCC |
| InChI | InChI=1S/C23H32O3/c1-4-19-26-20(21(24)25-5-2)11-7-10-12-22(3)15-17-23(18-16-22)13-8-6-9-14-23/h7-10,13-18,20H,4-6,11-12,19H2,1-3H3/b10-7+ |
| InChIKey | MSGCRPNZPLAYIB-JXMROGBWSA-N |
| XLogP | 5.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|