C22H32O3 — CID 71098436
ethyl (Z)-2-methoxy-6-[(5Z,8Z,11Z)-1-methylcyclododeca-2,5,8,11-tetraen-1-yl]hex-5-enoate (PubChem CID 71098436) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is ethyl (Z)-2-methoxy-6-[(5Z,8Z,11Z)-1-methylcyclododeca-2,5,8,11-tetraen-1-yl]hex-5-enoate.
| Compound Name | ethyl (Z)-2-methoxy-6-[(5Z,8Z,11Z)-1-methylcyclododeca-2,5,8,11-tetraen-1-yl]hex-5-enoate |
|---|---|
| PubChem CID | 71098436 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | ethyl (Z)-2-methoxy-6-[(5Z,8Z,11Z)-1-methylcyclododeca-2,5,8,11-tetraen-1-yl]hex-5-enoate |
| SMILES | CCOC(=O)C(CC/C=C\C1(C)C=CC/C=C\C/C=C\C/C=C\1)OC |
| InChI | InChI=1S/C22H32O3/c1-4-25-21(23)20(24-3)16-12-15-19-22(2)17-13-10-8-6-5-7-9-11-14-18-22/h6-9,13-15,17-20H,4-5,10-12,16H2,1-3H3/b8-6-,9-7-,17-13-,18-14?,19-15- |
| InChIKey | PMHXHNYDLFOQRG-PGOKXZBKSA-N |
| XLogP | 5.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|