About 4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-2-amine
4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-2-amine (PubChem CID 71098547) has the molecular formula C17H13Cl2N5OS
and a molecular weight of 406.30 g/mol. Its IUPAC name is 4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-2-amine |
| PubChem CID | 71098547 |
| Molecular Formula | C17H13Cl2N5OS |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-2-amine |
| SMILES | Nc1nc(-c2c(Cl)cc(Cl)cc2OCCn2cccn2)c2ccsc2n1 |
| InChI | InChI=1S/C17H13Cl2N5OS/c18-10-8-12(19)14(13(9-10)25-6-5-24-4-1-3-21-24)15-11-2-7-26-16(11)23-17(20)22-15/h1-4,7-9H,5-6H2,(H2,20,22,23) |
| InChIKey | BIXAONHVHYAOSZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-2-amine?
The IUPAC name of 4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-2-amine (CID 71098547) is 4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-2-amine.
What is the SMILES notation for 4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-2-amine?
The canonical SMILES for 4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-2-amine is Nc1nc(-c2c(Cl)cc(Cl)cc2OCCn2cccn2)c2ccsc2n1.
What is the InChIKey of 4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-2-amine?
The InChIKey is BIXAONHVHYAOSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Cl2N5OS/c18-10-8-12(19)14(13(9-10)25-6-5-24-4-1-3-21-24)15-11-2-7-26-16(11)23-17(20)22-15/h1-4,7-9H,5-6H2,(H2,20,22,23).
What are the key properties of 4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-2-amine?
4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-2-amine has a molecular weight of 406.30 g/mol, XLogP of 4.52, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-2-amine is sourced from PubChem (CID 71098547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).