2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid

C19H22O2 — CID 71098671

IUPAC2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid
SMILESCc1cc(C(=O)O)c(-c2cccc(C(C)(C)C)c2)cc1C
InChIInChI=1S/C19H22O2/c1-12-9-16(17(18(20)21)10-13(12)2)14-7-6-8-15(11-14)19(3,4)5/h6-11H,1-5H3,(H,20,21)
InChIKeyMIQIGKXDXGIWFV-UHFFFAOYSA-N
MW282.38 g/mol
LogP4.97
Rot. Bonds2

About 2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid

2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid (PubChem CID 71098671) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid.

Molecular Properties

Compound Name2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid
PubChem CID71098671
Molecular FormulaC19H22O2
Molecular Weight282.38 g/mol
Exact Mass282.16
IUPAC Name2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid
SMILESCc1cc(C(=O)O)c(-c2cccc(C(C)(C)C)c2)cc1C
InChIInChI=1S/C19H22O2/c1-12-9-16(17(18(20)21)10-13(12)2)14-7-6-8-15(11-14)19(3,4)5/h6-11H,1-5H3,(H,20,21)
InChIKeyMIQIGKXDXGIWFV-UHFFFAOYSA-N
XLogP4.97
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.38
LogP ≤ 54.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid?
The IUPAC name of 2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid (CID 71098671) is 2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid.
What is the SMILES notation for 2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid?
The canonical SMILES for 2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid is Cc1cc(C(=O)O)c(-c2cccc(C(C)(C)C)c2)cc1C.
What is the InChIKey of 2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid?
The InChIKey is MIQIGKXDXGIWFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O2/c1-12-9-16(17(18(20)21)10-13(12)2)14-7-6-8-15(11-14)19(3,4)5/h6-11H,1-5H3,(H,20,21).
What are the key properties of 2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid?
2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid has a molecular weight of 282.38 g/mol, XLogP of 4.97, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-tert-butylphenyl)-4,5-dimethylbenzoic acid is sourced from PubChem (CID 71098671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).