About (3R,6R)-6-methyl-3-(2-trimethylsilylethynyl)-2,6-dihydropyran-3-ol
(3R,6R)-6-methyl-3-(2-trimethylsilylethynyl)-2,6-dihydropyran-3-ol (PubChem CID 71098728) has the molecular formula C11H18O2Si
and a molecular weight of 210.35 g/mol. Its IUPAC name is (3R,6R)-6-methyl-3-(2-trimethylsilylethynyl)-2,6-dihydropyran-3-ol.
Molecular Properties
| Compound Name | (3R,6R)-6-methyl-3-(2-trimethylsilylethynyl)-2,6-dihydropyran-3-ol |
| PubChem CID | 71098728 |
| Molecular Formula | C11H18O2Si |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (3R,6R)-6-methyl-3-(2-trimethylsilylethynyl)-2,6-dihydropyran-3-ol |
| SMILES | C[C@@H]1C=C[C@@](O)(C#C[Si](C)(C)C)CO1 |
| InChI | InChI=1S/C11H18O2Si/c1-10-5-6-11(12,9-13-10)7-8-14(2,3)4/h5-6,10,12H,9H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | XHSPBYRJJGYOEB-GHMZBOCLSA-N |
| XLogP | 1.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R,6R)-6-methyl-3-(2-trimethylsilylethynyl)-2,6-dihydropyran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,6R)-6-methyl-3-(2-trimethylsilylethynyl)-2,6-dihydropyran-3-ol?
The IUPAC name of (3R,6R)-6-methyl-3-(2-trimethylsilylethynyl)-2,6-dihydropyran-3-ol (CID 71098728) is (3R,6R)-6-methyl-3-(2-trimethylsilylethynyl)-2,6-dihydropyran-3-ol.
What is the SMILES notation for (3R,6R)-6-methyl-3-(2-trimethylsilylethynyl)-2,6-dihydropyran-3-ol?
The canonical SMILES for (3R,6R)-6-methyl-3-(2-trimethylsilylethynyl)-2,6-dihydropyran-3-ol is C[C@@H]1C=C[C@@](O)(C#C[Si](C)(C)C)CO1.
What is the InChIKey of (3R,6R)-6-methyl-3-(2-trimethylsilylethynyl)-2,6-dihydropyran-3-ol?
The InChIKey is XHSPBYRJJGYOEB-GHMZBOCLSA-N. The full InChI is InChI=1S/C11H18O2Si/c1-10-5-6-11(12,9-13-10)7-8-14(2,3)4/h5-6,10,12H,9H2,1-4H3/t10-,11-/m1/s1.
What are the key properties of (3R,6R)-6-methyl-3-(2-trimethylsilylethynyl)-2,6-dihydropyran-3-ol?
(3R,6R)-6-methyl-3-(2-trimethylsilylethynyl)-2,6-dihydropyran-3-ol has a molecular weight of 210.35 g/mol, XLogP of 1.57, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,6R)-6-methyl-3-(2-trimethylsilylethynyl)-2,6-dihydropyran-3-ol is sourced from PubChem (CID 71098728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).