C45H30F3N7O3 — CID 71098996
4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-N-[4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]phenyl]aniline (PubChem CID 71098996) has the molecular formula C45H30F3N7O3 and a molecular weight of 773.78 g/mol. Its IUPAC name is 4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-N-[4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]phenyl]aniline.
| Compound Name | 4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-N-[4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]phenyl]aniline |
|---|---|
| PubChem CID | 71098996 |
| Molecular Formula | C45H30F3N7O3 |
| Molecular Weight | 773.78 g/mol |
| Exact Mass | 773.24 |
| IUPAC Name | 4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]-N-[4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]phenyl]aniline |
| SMILES | Cc1ccc(-c2nnc(-c3ccc(N(c4ccc(-c5nnc(-c6ccc(C)cc6)o5)cc4)c4ccc(-c5nnc(-c6ccc(C(F)(F)F)cc6)o5)cc4)cc3)o2)cc1 |
| InChI | InChI=1S/C45H30F3N7O3/c1-27-3-7-29(8-4-27)39-49-52-42(56-39)32-13-21-36(22-14-32)55(37-23-15-33(16-24-37)43-53-50-40(57-43)30-9-5-28(2)6-10-30)38-25-17-34(18-26-38)44-54-51-41(58-44)31-11-19-35(20-12-31)45(46,47)48/h3-26H,1-2H3 |
| InChIKey | PBBLCKBWFMJRNF-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 120.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.78 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |