C22H39N3O4 — CID 71099113
ethyl (E,4S)-4-[[2-[[1-(dimethylamino)cyclohexanecarbonyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoate (PubChem CID 71099113) has the molecular formula C22H39N3O4 and a molecular weight of 409.57 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[2-[[1-(dimethylamino)cyclohexanecarbonyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[2-[[1-(dimethylamino)cyclohexanecarbonyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 71099113 |
| Molecular Formula | C22H39N3O4 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.29 |
| IUPAC Name | ethyl (E,4S)-4-[[2-[[1-(dimethylamino)cyclohexanecarbonyl]amino]acetyl]-methylamino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)CNC(=O)C1(N(C)C)CCCCC1 |
| InChI | InChI=1S/C22H39N3O4/c1-8-29-20(27)17(4)14-18(16(2)3)25(7)19(26)15-23-21(28)22(24(5)6)12-10-9-11-13-22/h14,16,18H,8-13,15H2,1-7H3,(H,23,28)/b17-14+/t18-/m1/s1 |
| InChIKey | OWTZEJJTOCDWCJ-UWXVCKHVSA-N |
| XLogP | 2.36 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|