About N-[[(1R,2R)-2-fluorocyclohexyl]methyl]pyrimidin-2-amine
N-[[(1R,2R)-2-fluorocyclohexyl]methyl]pyrimidin-2-amine (PubChem CID 71099772) has the molecular formula C11H16FN3
and a molecular weight of 209.27 g/mol. Its IUPAC name is N-[[(1R,2R)-2-fluorocyclohexyl]methyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[[(1R,2R)-2-fluorocyclohexyl]methyl]pyrimidin-2-amine |
| PubChem CID | 71099772 |
| Molecular Formula | C11H16FN3 |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | N-[[(1R,2R)-2-fluorocyclohexyl]methyl]pyrimidin-2-amine |
| SMILES | F[C@@H]1CCCC[C@@H]1CNc1ncccn1 |
| InChI | InChI=1S/C11H16FN3/c12-10-5-2-1-4-9(10)8-15-11-13-6-3-7-14-11/h3,6-7,9-10H,1-2,4-5,8H2,(H,13,14,15)/t9-,10-/m1/s1 |
| InChIKey | DWJWLBJGALHTCN-NXEZZACHSA-N |
| XLogP | 2.42 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(1R,2R)-2-fluorocyclohexyl]methyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1R,2R)-2-fluorocyclohexyl]methyl]pyrimidin-2-amine?
The IUPAC name of N-[[(1R,2R)-2-fluorocyclohexyl]methyl]pyrimidin-2-amine (CID 71099772) is N-[[(1R,2R)-2-fluorocyclohexyl]methyl]pyrimidin-2-amine.
What is the SMILES notation for N-[[(1R,2R)-2-fluorocyclohexyl]methyl]pyrimidin-2-amine?
The canonical SMILES for N-[[(1R,2R)-2-fluorocyclohexyl]methyl]pyrimidin-2-amine is F[C@@H]1CCCC[C@@H]1CNc1ncccn1.
What is the InChIKey of N-[[(1R,2R)-2-fluorocyclohexyl]methyl]pyrimidin-2-amine?
The InChIKey is DWJWLBJGALHTCN-NXEZZACHSA-N. The full InChI is InChI=1S/C11H16FN3/c12-10-5-2-1-4-9(10)8-15-11-13-6-3-7-14-11/h3,6-7,9-10H,1-2,4-5,8H2,(H,13,14,15)/t9-,10-/m1/s1.
What are the key properties of N-[[(1R,2R)-2-fluorocyclohexyl]methyl]pyrimidin-2-amine?
N-[[(1R,2R)-2-fluorocyclohexyl]methyl]pyrimidin-2-amine has a molecular weight of 209.27 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1R,2R)-2-fluorocyclohexyl]methyl]pyrimidin-2-amine is sourced from PubChem (CID 71099772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).