C28H51NO14 — CID 71100067
ethyl (3S,4R,5S,6R)-3-[2-[(2R,3S,4R,5S)-6-[ethyl(4-hydroxybutyl)carbamoyl]-3,4-dihydroxy-5-propan-2-yloxyoxan-2-yl]oxyethoxy]-4,5-dihydroxy-6-propan-2-yloxyoxane-2-carboxylate (PubChem CID 71100067) has the molecular formula C28H51NO14 and a molecular weight of 625.71 g/mol. Its IUPAC name is ethyl (3S,4R,5S,6R)-3-[2-[(2R,3S,4R,5S)-6-[ethyl(4-hydroxybutyl)carbamoyl]-3,4-dihydroxy-5-propan-2-yloxyoxan-2-yl]oxyethoxy]-4,5-dihydroxy-6-propan-2-yloxyoxane-2-carboxylate.
| Compound Name | ethyl (3S,4R,5S,6R)-3-[2-[(2R,3S,4R,5S)-6-[ethyl(4-hydroxybutyl)carbamoyl]-3,4-dihydroxy-5-propan-2-yloxyoxan-2-yl]oxyethoxy]-4,5-dihydroxy-6-propan-2-yloxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 71100067 |
| Molecular Formula | C28H51NO14 |
| Molecular Weight | 625.71 g/mol |
| Exact Mass | 625.33 |
| IUPAC Name | ethyl (3S,4R,5S,6R)-3-[2-[(2R,3S,4R,5S)-6-[ethyl(4-hydroxybutyl)carbamoyl]-3,4-dihydroxy-5-propan-2-yloxyoxan-2-yl]oxyethoxy]-4,5-dihydroxy-6-propan-2-yloxyoxane-2-carboxylate |
| SMILES | CCOC(=O)C1O[C@@H](OC(C)C)[C@@H](O)[C@@H](O)[C@@H]1OCCO[C@@H]1OC(C(=O)N(CC)CCCCO)[C@@H](OC(C)C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H51NO14/c1-7-29(11-9-10-12-30)25(35)23-22(40-15(3)4)18(32)19(33)27(42-23)39-14-13-38-21-17(31)20(34)28(41-16(5)6)43-24(21)26(36)37-8-2/h15-24,27-28,30-34H,7-14H2,1-6H3/t17-,18-,19+,20+,21+,22+,23?,24?,27-,28-/m1/s1 |
| InChIKey | XGLIBSGOZTYARQ-XNJFPOALSA-N |
| XLogP | -1.32 |
| TPSA | 203.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.71 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|