C24H29FO5 — CID 71100355
(2E,5S,9S,11E,13R,14S)-11-fluoro-7,7,13,14,18,20-hexamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione (PubChem CID 71100355) has the molecular formula C24H29FO5 and a molecular weight of 416.49 g/mol. Its IUPAC name is (2E,5S,9S,11E,13R,14S)-11-fluoro-7,7,13,14,18,20-hexamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione.
| Compound Name | (2E,5S,9S,11E,13R,14S)-11-fluoro-7,7,13,14,18,20-hexamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione |
|---|---|
| PubChem CID | 71100355 |
| Molecular Formula | C24H29FO5 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (2E,5S,9S,11E,13R,14S)-11-fluoro-7,7,13,14,18,20-hexamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaene-10,16-dione |
| SMILES | Cc1cc(C)c2c(c1)/C=C/C[C@@H]1OC(C)(C)O[C@@H]1C(=O)/C(F)=C\[C@@H](C)[C@H](C)OC2=O |
| InChI | InChI=1S/C24H29FO5/c1-13-10-15(3)20-17(11-13)8-7-9-19-22(30-24(5,6)29-19)21(26)18(25)12-14(2)16(4)28-23(20)27/h7-8,10-12,14,16,19,22H,9H2,1-6H3/b8-7+,18-12+/t14-,16+,19+,22+/m1/s1 |
| InChIKey | ZINHLLWQQFCFHD-GDFLGNLDSA-N |
| XLogP | 4.84 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|