About 1,3-dimethyl-5-[(2-methylpropan-2-yl)oxymethyl]-1,3-diazinane
1,3-dimethyl-5-[(2-methylpropan-2-yl)oxymethyl]-1,3-diazinane (PubChem CID 71100466) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(2-methylpropan-2-yl)oxymethyl]-1,3-diazinane.
Molecular Properties
| Compound Name | 1,3-dimethyl-5-[(2-methylpropan-2-yl)oxymethyl]-1,3-diazinane |
| PubChem CID | 71100466 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 1,3-dimethyl-5-[(2-methylpropan-2-yl)oxymethyl]-1,3-diazinane |
| SMILES | CN1CC(COC(C)(C)C)CN(C)C1 |
| InChI | InChI=1S/C11H24N2O/c1-11(2,3)14-8-10-6-12(4)9-13(5)7-10/h10H,6-9H2,1-5H3 |
| InChIKey | KZJAGALGIXIGSS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dimethyl-5-[(2-methylpropan-2-yl)oxymethyl]-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5-[(2-methylpropan-2-yl)oxymethyl]-1,3-diazinane?
The IUPAC name of 1,3-dimethyl-5-[(2-methylpropan-2-yl)oxymethyl]-1,3-diazinane (CID 71100466) is 1,3-dimethyl-5-[(2-methylpropan-2-yl)oxymethyl]-1,3-diazinane.
What is the SMILES notation for 1,3-dimethyl-5-[(2-methylpropan-2-yl)oxymethyl]-1,3-diazinane?
The canonical SMILES for 1,3-dimethyl-5-[(2-methylpropan-2-yl)oxymethyl]-1,3-diazinane is CN1CC(COC(C)(C)C)CN(C)C1.
What is the InChIKey of 1,3-dimethyl-5-[(2-methylpropan-2-yl)oxymethyl]-1,3-diazinane?
The InChIKey is KZJAGALGIXIGSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O/c1-11(2,3)14-8-10-6-12(4)9-13(5)7-10/h10H,6-9H2,1-5H3.
What are the key properties of 1,3-dimethyl-5-[(2-methylpropan-2-yl)oxymethyl]-1,3-diazinane?
1,3-dimethyl-5-[(2-methylpropan-2-yl)oxymethyl]-1,3-diazinane has a molecular weight of 200.33 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-[(2-methylpropan-2-yl)oxymethyl]-1,3-diazinane is sourced from PubChem (CID 71100466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).