C21H18O2S — CID 71100786
4-methylsulfonylpentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9,11,13,15(20),16-octaene (PubChem CID 71100786) has the molecular formula C21H18O2S and a molecular weight of 334.44 g/mol. Its IUPAC name is 4-methylsulfonylpentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9,11,13,15(20),16-octaene.
| Compound Name | 4-methylsulfonylpentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9,11,13,15(20),16-octaene |
|---|---|
| PubChem CID | 71100786 |
| Molecular Formula | C21H18O2S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-methylsulfonylpentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9,11,13,15(20),16-octaene |
| SMILES | CS(=O)(=O)c1ccc2c(c1)C1C3=C(CCC=C3)C2c2ccccc21 |
| InChI | InChI=1S/C21H18O2S/c1-24(22,23)13-10-11-18-19(12-13)21-16-8-4-2-6-14(16)20(18)15-7-3-5-9-17(15)21/h2,4-6,8-12,20-21H,3,7H2,1H3 |
| InChIKey | HXKVCEWROZRWLA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |