C17H32O2 — CID 71100930
2,2,5-trimethyl-3-[(2,2,5-trimethyloxan-3-yl)methyl]oxane (PubChem CID 71100930) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is 2,2,5-trimethyl-3-[(2,2,5-trimethyloxan-3-yl)methyl]oxane.
| Compound Name | 2,2,5-trimethyl-3-[(2,2,5-trimethyloxan-3-yl)methyl]oxane |
|---|---|
| PubChem CID | 71100930 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 2,2,5-trimethyl-3-[(2,2,5-trimethyloxan-3-yl)methyl]oxane |
| SMILES | CC1COC(C)(C)C(CC2CC(C)COC2(C)C)C1 |
| InChI | InChI=1S/C17H32O2/c1-12-7-14(16(3,4)18-10-12)9-15-8-13(2)11-19-17(15,5)6/h12-15H,7-11H2,1-6H3 |
| InChIKey | NFNYSQBKDYUJES-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |