C25H28FN7O3S2 — CID 71100956
5-amino-N-[4-[3-(dimethylamino)propylsulfamoyl]phenyl]-4-(4-fluoro-3-methylanilino)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 71100956) has the molecular formula C25H28FN7O3S2 and a molecular weight of 557.68 g/mol. Its IUPAC name is 5-amino-N-[4-[3-(dimethylamino)propylsulfamoyl]phenyl]-4-(4-fluoro-3-methylanilino)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 5-amino-N-[4-[3-(dimethylamino)propylsulfamoyl]phenyl]-4-(4-fluoro-3-methylanilino)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 71100956 |
| Molecular Formula | C25H28FN7O3S2 |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 5-amino-N-[4-[3-(dimethylamino)propylsulfamoyl]phenyl]-4-(4-fluoro-3-methylanilino)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1cc(Nc2ncnc3sc(C(=O)Nc4ccc(S(=O)(=O)NCCCN(C)C)cc4)c(N)c23)ccc1F |
| InChI | InChI=1S/C25H28FN7O3S2/c1-15-13-17(7-10-19(15)26)31-23-20-21(27)22(37-25(20)29-14-28-23)24(34)32-16-5-8-18(9-6-16)38(35,36)30-11-4-12-33(2)3/h5-10,13-14,30H,4,11-12,27H2,1-3H3,(H,32,34)(H,28,29,31) |
| InChIKey | FYLSIRGQXLXWCW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 142.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|